티아넵틴: 두 판 사이의 차이
보이기
내용 삭제됨 내용 추가됨
편집 요약 없음 |
편집 요약 없음 |
||
1번째 줄: | 1번째 줄: | ||
{{Drugbox |
|||
| Verifiedfields = changed |
|||
| Watchedfields = changed |
|||
| verifiedrevid = 455249171 |
|||
| IUPAC_name = 7-[(3-Chloro-6-methyl-5,5-dioxo-11''H''-benzo[''c''][2,1]benzothiazepin-11-yl)amino]heptanoic acid |
|||
| image = Tianeptine2DACS.svg |
|||
| width = 225px |
|||
| image2 = Tianeptine molecule ball.png |
|||
| width2 = 225px |
|||
<!--Clinical data--> |
|||
| tradename = Stablon, Coaxil, others |
|||
| Drugs.com = {{drugs.com|international|tianeptine}} |
|||
| legal_status = In general: Rx-only<br>[[United States|US]]: not FDA approved, unscheduled<br>[[Australia|AU]]: [[Standard for the Uniform Scheduling of Medicines and Poisons#Schedule 4: Prescription only medicine|S4]]<ref>[https://www.legislation.gov.au/Details/F2017L00605]</ref><br>Others: controlled in [[France|FR]], [[Bahrain|BH]], [[Singapore|SG]]) |
|||
| routes_of_administration = [[Oral administration|By mouth]] |
|||
<!--Pharmacokinetic data--> |
|||
| bioavailability = 99%<ref name="pmid3180120">{{cite journal |author1=Royer, RJ |author2=Albin, H |author3=Barrucand, D |author4=Salvadori-Failler, C |author5=Kamoun, A |title = Pharmacokinetic and metabolic parameters of tianeptine in healthy volunteers and in populations with risk factors | journal = Clinical Neuropharmacology | volume = 11 Suppl 2 | issue = | pages = S90–6 | year = 1988 | pmid = 3180120 | doi = | url = }}</ref><ref name = Tian2001>{{cite journal|title=Tianeptine A Review of its Use in Depressive Disorders|journal=CNS Drugs|date=March 2001|volume=15|issue=3|doi=10.2165/00023210-200115030-00006|pages=231–259|pmid=11463130|author1=Wagstaff, AJ |author2=Ormrod, D |author3=Spencer, CM }}</ref> |
|||
| protein_bound = 95%<ref name = Tian2001/> |
|||
| metabolism = [[Hepatic]]<ref name = Tian2001/> |
|||
| elimination_half-life = 2.5–3 hours<ref name="pmid3180120" /><ref name = Tian2001/><br />4–9 hours ([[elderly]])<ref name =Tian2001/><ref name="CarlhantLeGarrec1990">{{cite journal|title=Pharmacokinetics and bioavailability of tianeptine in the elderly|journal=Drug Investigation|date=September 1990|volume=2|issue=3|pages=167–172|doi=10.1007/BF03259191|author1=Carlhant, D |author2=Le Garrec, J |author3=Guedes, Y |author4=Salvadori, C |author5=Mottier, D |author6=Riche, C }}</ref> |
|||
| excretion = [[Urine]]: 65%<ref name="pmid3180120" /><br />[[Feces]]: 15%<ref name =Tian2001/> |
|||
<!--Identifiers--> |
|||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
| CAS_number = 66981-73-5 |
|||
| CAS_supplemental = <br />30123-17-2 ([[sodium]])<br />1224690-84-9 ([[sulfate]]) |
|||
| ATC_prefix = N06 |
|||
| ATC_suffix = AX14 |
|||
| PubChem = 68870 |
|||
| IUPHAR_ligand = 7558 |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| ChemSpiderID = 62102 |
|||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|||
| ChEMBL = 1289110 |
|||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| UNII = 0T493YFU8O |
|||
| KEGG_Ref = {{keggcite|correct|kegg}} |
|||
| KEGG = D02575 |
|||
| synonyms = S-1574;<ref name="Elks2014" /><ref name="IndexNominum2000" /><ref name="Drugs.com" /> JNJ-39823277; TPI-1062<ref name="AdisInsight" /> |
|||
<!--Chemical data--> |
|||
| C=21 | H=25 | Cl=1 | N=2 | O=4 | S=1 |
|||
| molecular_weight = 458.933 g/mol |
|||
| SMILES = Clc1cc2c(cc1)C(c3c(N(C)S2(=O)=O)cccc3)NCCCCCCC(=O)O |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChI = 1S/C21H24ClN2NaO4S/c1-24-18-9-6-5-8-16(18)21(23-13-7-3-2-4-10-20(25)26)17-12-11-15(22)14-19(17)29(24,27)28/h5-6,8-9,11-12,14,21,23H,2-4,7,10,13H2,1H3,(H,25,26) |
|||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChIKey = JICJBGPOMZQUBB-UHFFFAOYSA-N |
|||
}} |
|||
'''티아넵틴'''(Tianeptine, 상품명으로 '스타브론' 등이 사용된다)은 국내 업체인 [[제일약품]]에서 생산하는 항우울제이다. |
'''티아넵틴'''(Tianeptine, 상품명으로 '스타브론' 등이 사용된다)은 국내 업체인 [[제일약품]]에서 생산하는 항우울제이다. |
||
5번째 줄: | 55번째 줄: | ||
더욱이, 노인성 우울 장애 완화는 물론 인지기능개선에 도움돼 치매 및 기억력 저하를 예방하여, 집중인지장애에 효과적인 약물로 판단되어, 임상적으로 가장 효과적인 약제로 입증되었다. |
더욱이, 노인성 우울 장애 완화는 물론 인지기능개선에 도움돼 치매 및 기억력 저하를 예방하여, 집중인지장애에 효과적인 약물로 판단되어, 임상적으로 가장 효과적인 약제로 입증되었다. |
||
== 각주 == |
|||
{{각주}} |
|||
{{항우울제}} |
{{항우울제}} |
2019년 4월 5일 (금) 21:53 판
![]() | |
![]() | |
체계적 명칭 (IUPAC 명명법) | |
---|---|
7-[(3-Chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-yl)amino]heptanoic acid | |
식별 정보 | |
CAS 등록번호 | 66981-73-5 30123-17-2 (sodium) 1224690-84-9 (sulfate) |
ATC 코드 | N06AX14 |
PubChem | 68870 |
ChemSpider | 62102 |
화학적 성질 | |
화학식 | C21H25ClN2O4S |
분자량 | 458.933 g/mol |
유의어 | S-1574;[1][2][3] JNJ-39823277; TPI-1062[4] |
약동학 정보 | |
생체적합성 | 99%[5][6] |
단백질 결합 | 95%[6] |
동등생물의약품 | ? |
약물 대사 | Hepatic[6] |
생물학적 반감기 | 2.5–3 hours[5][6] 4–9 hours (elderly)[6][7] |
배출 | Urine: 65%[5] Feces: 15%[6] |
처방 주의사항 | |
임부투여안전성 | ? |
법적 상태 | |
투여 방법 | By mouth |
티아넵틴(Tianeptine, 상품명으로 '스타브론' 등이 사용된다)은 국내 업체인 제일약품에서 생산하는 항우울제이다.
작용 기전
선택적 세로토닌 재흡수 증진제(SSRE)에 속하는 항우울제로, 전형적인 삼환계 항우울제(TCA)와는 달리, AMPA, NMDA 수용체 및 아편 수용체에도 작용하여 항불안, 항경련, 진통작용을 가진다. 기존 세로토닌과 노르에피네프린 등에 작용하는 기존 항우울제와 다른 기전으로 작용한다. 긴장, 고통, 통증을 유발하는 신경전달물질인 글루타메이트를 줄여주는 역할을 하므로, 우울증 완화 뿐만 아니라 불안 장애 완화 효과도 동시에 가지고 있다.
더욱이, 노인성 우울 장애 완화는 물론 인지기능개선에 도움돼 치매 및 기억력 저하를 예방하여, 집중인지장애에 효과적인 약물로 판단되어, 임상적으로 가장 효과적인 약제로 입증되었다.
각주
- ↑ 인용 오류:
<ref>
태그가 잘못되었습니다;Elks2014
라는 이름을 가진 주석에 텍스트가 없습니다 - ↑ 인용 오류:
<ref>
태그가 잘못되었습니다;IndexNominum2000
라는 이름을 가진 주석에 텍스트가 없습니다 - ↑ 인용 오류:
<ref>
태그가 잘못되었습니다;Drugs.com
라는 이름을 가진 주석에 텍스트가 없습니다 - ↑ 인용 오류:
<ref>
태그가 잘못되었습니다;AdisInsight
라는 이름을 가진 주석에 텍스트가 없습니다 - ↑ 가 나 다 Royer, RJ; Albin, H; Barrucand, D; Salvadori-Failler, C; Kamoun, A (1988). “Pharmacokinetic and metabolic parameters of tianeptine in healthy volunteers and in populations with risk factors”. 《Clinical Neuropharmacology》. 11 Suppl 2: S90–6. PMID 3180120.
- ↑ 가 나 다 라 마 바 Wagstaff, AJ; Ormrod, D; Spencer, CM (March 2001). “Tianeptine A Review of its Use in Depressive Disorders”. 《CNS Drugs》 15 (3): 231–259. doi:10.2165/00023210-200115030-00006. PMID 11463130.
- ↑ Carlhant, D; Le Garrec, J; Guedes, Y; Salvadori, C; Mottier, D; Riche, C (September 1990). “Pharmacokinetics and bioavailability of tianeptine in the elderly”. 《Drug Investigation》 2 (3): 167–172. doi:10.1007/BF03259191.
- ↑ [1]