
위키백과, 우리 모두의 백과사전.
둘러보기로 가기 검색하러 가기

{{Drugbox | Verifiedfields = changed | verifiedrevid = 464192413 | IUPAC_name = 2-(2-{4-[(R)-(4-chlorophenyl)(phenyl)methyl]piperazin-1-yl}ethoxy)acetic acid | image = Levocetirizine structure 2.svg | width = 280 | image2 = Levocetirizine 3D ball.png | alt2 = Ball-and-stick model of the levocetirizine molecule

| tradename = Xyzal | Drugs.com = Monograph | MedlinePlus = a607056 | pregnancy_AU = | pregnancy_US = B | pregnancy_category = | legal_AU = | legal_UK = POM | legal_US = Rx-only | routes_of_administration = 구강

| bioavailability = 높음 | protein_bound = 90% | metabolism = 14% CYP3A4 | elimination_half-life = 6 ~ 10시간 | excretion = 콩팥 및 배설물

| CAS_number_Ref = 틀:Cascite | CAS_number = 130018-77-8 | ATC_prefix = R06 | ATC_suffix = AE09 | PubChem = 1549000 | IUPHAR_ligand = 1214 | DrugBank_Ref = 틀:Drugbankcite | DrugBank = | ChemSpiderID_Ref = 틀:Chemspidercite | ChemSpiderID = 1266001 | UNII_Ref = 틀:Fdacite | UNII = 6U5EA9RT2O | KEGG_Ref = 틀:Keggcite | KEGG = D07402 | ChEMBL_Ref = 틀:Ebicite | ChEMBL = 1201191

| C=21 | H=25 | Cl=1 | N=2 | O=3 | molecular_weight = 388.888 g/mol | smiles = Clc1ccc(cc1)[C@H](N2CCN(CCOCC(=O)O)CC2)c3ccccc3 | InChI = 1/C21H25ClN2O3/c22-19-8-6-18(7-9-19)21(17-4-2-1-3-5-17)24-12-10-23(11-13-24)14-15-27-16-20(25)26/h1-9,21H,10-16H2,(H,25,26)/t21-/m1/s1 | InChIKey = ZKLPARSLTMPFCP-OAQYLSRUBZ | StdInChI_Ref = 틀:Stdinchicite | StdInChI = 1S/C21H25ClN2O3/c22-19-8-6-18(7-9-19)21(17-4-2-1-3-5-17)24-12-10-23(11-13-24)14-15-27-16-20(25)26/h1-9,21H,10-16H2,(H,25,26)/t21-/m1/s1 | StdInChIKey_Ref = 틀:Stdinchicite | StdInChIKey = ZKLPARSLTMPFCP-OAQYLSRUSA-N }}

레보세티리진(Levocetirizine) 또는 레보세티리진 중염산염(levocetirizine dihydrochloride), 브랜드명 씨잘(Xyzal)은 3세대 비진정성 항히스타민제로, 2세대 세티리진보다 더욱 발전된 형태이다. 화학적으로, 레보세티리진은 세티리진의 활성된 광학 이성질체이다. 라세미 혼합물 이성질체의 R-세티리진이기도 하다. 레보세티리진은 히스타민 수용체를 차단하는 작용을 한다. 이 물질은 비만 세포의 실제적인 히스타민 방출을 억제하진 않지만, 수용체와 결합을 막는 형식이다. 이것은 차례대로 알러지 물질 방출을 방지하고 혈액 공급을 증가시켜 전형적인 발열 증세를 막는다.

이 물질의 제조업체는 2세대 약물보다 부작용이 더 적다고 주장한다. 그러나, 다른 연구에서는 더 효과적이라는 연구가 있지만 지지하는 출판 연구는 존재하지 않는다.[1]


레보세티리진은 비진정성 항히스타민제로 상당한 양을 먹어도 뇌에 영향을 주지 않고 졸음을 일으킬 가능성은 없다. 그러나, 일부 사람들에게 졸림, 두통, 구강건조증, 몽롱함, 시력 문제(주로 시야 흐림), 심계항진, 피로 등의 증상이 나타나는 것이 보고되었다.[2]


가장 최근의 연구인 2006년 9월에서는 레보세티리진이 어린이 천식 발작을 70% 경감해 주는 것으로 나타났다.[3]


  1. Grant, JA; Riethuisen, JM; Moulaert, B; DeVos, C; Gamalero, C.; Descalzi, D.; Folli, C.; Passalacqua, G.; Canonica, G.W. (2002년 2월). “A double-blind, randomized, single-dose, crossover comparison of levocetirizine with ebastine, fexofenadine, loratadine, mizolastine, and placebo: suppression of histamine-induced wheal-and-flare response during 24 hours in healthy male subjects.”. 《Ann Allergy Asthma Immunol》 88 (2): 190–197. PMID 11868924. doi:10.1016/S1081-1206(10)61995-3. 
  2. XOZAL technical specifications booklet.
  3. Pasquali, M; Baiardini, I; Rogkakou, A; Riccio, AM; Gamalero, C; Descalzi, D; Folli, C; Passalacqua, G; Canonica, GW (September 2006). “Levocetirizine in persistent allergic rhinitis and asthma: effects on symptoms, quality of life and inflammatory parameters”. 《Clinical & Experimental Allergy》 36 (9): 1161–7. PMID 16961716. doi:10.1111/j.1365-2222.2006.02548.x. 

외부 링크[편집]