이부프로펜: 두 판 사이의 차이

위키백과, 우리 모두의 백과사전.
내용 삭제됨 내용 추가됨
TedBot (토론 | 기여)
잔글 봇: 틀 이름 및 스타일 정리
편집 요약 없음
1번째 줄: 1번째 줄:
{{Drugbox
[[파일:Ibuprofen-Enantiomere Strukturformeln.png|섬네일|right|250px|(±)-이부프로펜]]
| Watchedfields = changed
| verifiedrevid = 464191340
| IUPAC_name = (''RS'')-2-(4-(2-Methylpropyl)phenyl)propanoic acid
| image = (RS)-Ibuprofen Structural Formula V1.svg
| width = 200px
| image2 = Ibuprofen-3D-balls.png
| width2 = 250px
| alt2 = (R)-ibuprofen

<!--Clinical data-->
| pronounce = {{IPAc-en|ˈ|aɪ|b|juː|p|r|oʊ|f|ɛ|n}}, {{IPAc-en|aɪ|b|juː|ˈ|p|r|oʊ|f|ən}}, {{respell|EYE|bew|PROH|fən}}
| synonyms = isobutylphenylpropionic acid
| tradename = Advil, Motrin, Nurofen, [[List of ibuprofen brand names|others]]
| Drugs.com = {{drugs.com|monograph|ibuprofen}}
| MedlinePlus = a682159
| licence_US = Ibuprofen
| pregnancy_AU = C
| pregnancy_US = C
| pregnancy_category = D (US) at ≥30 weeks of gestation, due to the potential for premature closure of the ''[[ductus arteriosus]]''
| licence_EU = yes
| legal_AU = OTC
| legal_UK = GSL
| legal_US = OTC
| legal_US_comment = ([[prescription drug|{{Rx}}-only]] at higher doses)
| legal_CA = OTC
| routes_of_administration =by mouth, rectal, topical, and [[intravenous therapy|intravenous]]

<!--Pharmacokinetic data-->
| bioavailability = 80–100% (by mouth),<ref name="Davanzo2014">{{cite journal|last1=Davanzo|first1=R|last2=Bua|first2=J|last3=Paloni|first3=G|last4=Facchina|first4=G|title=Breastfeeding and migraine drugs|journal=European Journal of Clinical Pharmacology|date=November 2014|volume=70|issue=11|pages=1313–24|doi=10.1007/s00228-014-1748-0|pmid=25217187|type=Review}}</ref> 87% (rectal)
| protein_bound = 98%<ref name = clinp>{{cite journal|last=Davies|first=NM|title=Clinical pharmacokinetics of ibuprofen. The first 30 years.|journal=Clinical Pharmacokinetics|date=February 1998|volume=34|issue=2|pages=101–54|doi=10.2165/00003088-199834020-00002|pmid=9515184}}</ref>
| metabolism = Liver ([[CYP2C9]])<ref name = clinp/>
| metabolites = ibuprofen glucuronide, 2-hydroxyibuprofen, 3-hydroxyibuprofen, carboxy-ibuprofen, 1-hydroxyibuprofen
| elimination_half-life = 2–4 h<ref name="Grosser2017">{{cite journal|last1=Grosser|first1=T|last2=Ricciotti|first2=E|last3=FitzGerald|first3=GA|title=The Cardiovascular Pharmacology of Nonsteroidal Anti-Inflammatory Drugs|journal=Trends in Pharmacological Sciences|date=August 2017|volume=38|issue=8|pages=733–48|doi=10.1016/j.tips.2017.05.008|pmid=28651847|pmc=5676556|type=Review}}</ref>
| onset = 30&nbsp;min<ref>{{cite web|title=ibuprofen|url=http://web.squ.edu.om/med-lib/med_cd/e_cds/Nursing%20Drug%20Guide/mg/ibuprofen.htm|accessdate=31 January 2015|deadurl=no|archiveurl=https://web.archive.org/web/20150113042104/http://web.squ.edu.om/med-Lib/MED_CD/E_CDs/Nursing%20Drug%20Guide/mg/ibuprofen.htm|archivedate=13 January 2015|df=dmy-all}}</ref>
| excretion = Urine (95%)<ref name = clinp/><ref name=TGA>{{cite web|title=Brufen Tablets And Syrup|publisher=Therapeutic Goods Administration|date=31 July 2012|accessdate=8 May 2014|url=https://www.ebs.tga.gov.au/ebs/picmi/picmirepository.nsf/pdf?OpenAgent&id=CP-2009-PI-00035-3|format=PDF|deadurl=no|archiveurl=https://web.archive.org/web/20160820064609/https://www.ebs.tga.gov.au/ebs/picmi/picmirepository.nsf/pdf?OpenAgent&id=CP-2009-PI-00035-3|archivedate=20 August 2016|df=dmy-all}}</ref>

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 15687-27-1
| ATC_prefix = C01
| ATC_suffix = EB16
| ATC_supplemental = {{ATC|G02|CC01}} {{ATC|M01|AE01}} {{ATC|M02|AA13}} {{ATC|R02|AX02}}
| PubChem = 3672
| IUPHAR_ligand = 2713
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01050
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 3544
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = WK2XYI10QM
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00126
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 5855
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 521
| PDB_ligand = IBP

<!--Chemical data-->
| C=13 | H=18 | O=2
| molecular_weight = 206.29 g/mol
| smiles = CC(C)Cc1ccc(cc1)[C@@H](C)C(=O)O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = HEFNNWSXXWATRW-UHFFFAOYSA-N
| melting_point = 75
| melting_high = 78
| boiling_point = 157
| boiling_notes = at 4 mmHg
| solubility = 0.021
| density = 1.03 g/ml
| chirality = [[Racemic mixture]]
}}
'''이부프로펜'''(Ibuprofen, 이전 이름: 이소 부틸 프로판 페놀산)은 [[비스테로이드 항염증제]]로, 원래 상표명은 부루펜(Brufen)이다. 나라마다 다른 상표명이 있다. [[진통]], [[관절염]] 제거, [[해열]]에, 특히 이들 [[증상]]이 [[염증]]을 동반하는 경우에 쓴다. [[아스피린]]에 비해서는 약하면서도 반감기가 짧기는 하지만, [[용혈작용]]이 있다. [[아세트아미노펜]]과는 달리, [[위 (해부학)|위장]]에 영향을 줄 수 있으므로 공복을 피하여 복용해야 하며, 특히 [[술]]을 마신 상태에서 복용 시 위장 [[출혈]]을 유발할 수 있으므로 피해야 한다.
'''이부프로펜'''(Ibuprofen, 이전 이름: 이소 부틸 프로판 페놀산)은 [[비스테로이드 항염증제]]로, 원래 상표명은 부루펜(Brufen)이다. 나라마다 다른 상표명이 있다. [[진통]], [[관절염]] 제거, [[해열]]에, 특히 이들 [[증상]]이 [[염증]]을 동반하는 경우에 쓴다. [[아스피린]]에 비해서는 약하면서도 반감기가 짧기는 하지만, [[용혈작용]]이 있다. [[아세트아미노펜]]과는 달리, [[위 (해부학)|위장]]에 영향을 줄 수 있으므로 공복을 피하여 복용해야 하며, 특히 [[술]]을 마신 상태에서 복용 시 위장 [[출혈]]을 유발할 수 있으므로 피해야 한다.



2019년 3월 16일 (토) 12:18 판

이부프로펜
(R)-ibuprofen
체계적 명칭 (IUPAC 명명법)
(RS)-2-(4-(2-Methylpropyl)phenyl)propanoic acid
식별 정보
CAS 등록번호 15687-27-1
ATC 코드 C01EB16 G02CC01 M01AE01 M02AA13 R02AX02
PubChem 3672
드러그뱅크 DB01050
ChemSpider 3544
화학적 성질
화학식 C13H18O2 
분자량 206.29 g/mol
SMILES eMolecules & PubChem
유의어 isobutylphenylpropionic acid
물리적 성질
밀도 1.03 g/ml g/cm³
녹는점 75–78 °C (167–172 °F)
끓는점 157 °C (315 °F) at 4 mmHg
물에 대한 용해도 0.021 mg/mL (20 °C)
약동학 정보
생체적합성 80–100% (by mouth),[1] 87% (rectal)
단백질 결합 98%[2]
동등생물의약품 ?
약물 대사 Liver (CYP2C9)[2]
생물학적 반감기 2–4 h[3]
배출 Urine (95%)[2][4]
처방 주의사항
허가 정보

유럽 의약청:바로가기미국 식품의약국:바로가기

임부투여안전성 C(오스트레일리아)C(미국)D (US) at ≥30 weeks of gestation, due to the potential for premature closure of the ductus arteriosus
법적 상태
투여 방법 by mouth, rectal, topical, and intravenous

이부프로펜(Ibuprofen, 이전 이름: 이소 부틸 프로판 페놀산)은 비스테로이드 항염증제로, 원래 상표명은 부루펜(Brufen)이다. 나라마다 다른 상표명이 있다. 진통, 관절염 제거, 해열에, 특히 이들 증상염증을 동반하는 경우에 쓴다. 아스피린에 비해서는 약하면서도 반감기가 짧기는 하지만, 용혈작용이 있다. 아세트아미노펜과는 달리, 위장에 영향을 줄 수 있으므로 공복을 피하여 복용해야 하며, 특히 을 마신 상태에서 복용 시 위장 출혈을 유발할 수 있으므로 피해야 한다.

역사

이부프로펜은 1960년대 동안 부츠 그룹연구 부문에 의해 프로피온산에서 추출된 것이다.[5]

같이 보기

각주

  1. Davanzo, R; Bua, J; Paloni, G; Facchina, G (November 2014). “Breastfeeding and migraine drugs”. 《European Journal of Clinical Pharmacology》 (Review) 70 (11): 1313–24. doi:10.1007/s00228-014-1748-0. PMID 25217187. 
  2. Davies, NM (February 1998). “Clinical pharmacokinetics of ibuprofen. The first 30 years.”. 《Clinical Pharmacokinetics》 34 (2): 101–54. doi:10.2165/00003088-199834020-00002. PMID 9515184. 
  3. Grosser, T; Ricciotti, E; FitzGerald, GA (August 2017). “The Cardiovascular Pharmacology of Nonsteroidal Anti-Inflammatory Drugs”. 《Trends in Pharmacological Sciences》 (Review) 38 (8): 733–48. doi:10.1016/j.tips.2017.05.008. PMC 5676556. PMID 28651847. 
  4. “Brufen Tablets And Syrup”. Therapeutic Goods Administration. 31 July 2012. 20 August 2016에 보존된 문서. 8 May 2014에 확인함. 
  5. Adams, SS (April 1992). “The propionic acids: a personal perspective.”. 《Journal of Clinical Pharmacology》 32 (4): 317–23. doi:10.1002/j.1552-4604.1992.tb03842.x. PMID 1569234.