이부프로펜: 두 판 사이의 차이
내용 삭제됨 내용 추가됨
잔글 봇: 틀 이름 및 스타일 정리 |
편집 요약 없음 |
||
1번째 줄: | 1번째 줄: | ||
{{Drugbox |
|||
[[파일:Ibuprofen-Enantiomere Strukturformeln.png|섬네일|right|250px|(±)-이부프로펜]] |
|||
| Watchedfields = changed |
|||
| verifiedrevid = 464191340 |
|||
| IUPAC_name = (''RS'')-2-(4-(2-Methylpropyl)phenyl)propanoic acid |
|||
| image = (RS)-Ibuprofen Structural Formula V1.svg |
|||
| width = 200px |
|||
| image2 = Ibuprofen-3D-balls.png |
|||
| width2 = 250px |
|||
| alt2 = (R)-ibuprofen |
|||
<!--Clinical data--> |
|||
| pronounce = {{IPAc-en|ˈ|aɪ|b|juː|p|r|oʊ|f|ɛ|n}}, {{IPAc-en|aɪ|b|juː|ˈ|p|r|oʊ|f|ən}}, {{respell|EYE|bew|PROH|fən}} |
|||
| synonyms = isobutylphenylpropionic acid |
|||
| tradename = Advil, Motrin, Nurofen, [[List of ibuprofen brand names|others]] |
|||
| Drugs.com = {{drugs.com|monograph|ibuprofen}} |
|||
| MedlinePlus = a682159 |
|||
| licence_US = Ibuprofen |
|||
| pregnancy_AU = C |
|||
| pregnancy_US = C |
|||
| pregnancy_category = D (US) at ≥30 weeks of gestation, due to the potential for premature closure of the ''[[ductus arteriosus]]'' |
|||
| licence_EU = yes |
|||
| legal_AU = OTC |
|||
| legal_UK = GSL |
|||
| legal_US = OTC |
|||
| legal_US_comment = ([[prescription drug|{{Rx}}-only]] at higher doses) |
|||
| legal_CA = OTC |
|||
| routes_of_administration =by mouth, rectal, topical, and [[intravenous therapy|intravenous]] |
|||
<!--Pharmacokinetic data--> |
|||
| bioavailability = 80–100% (by mouth),<ref name="Davanzo2014">{{cite journal|last1=Davanzo|first1=R|last2=Bua|first2=J|last3=Paloni|first3=G|last4=Facchina|first4=G|title=Breastfeeding and migraine drugs|journal=European Journal of Clinical Pharmacology|date=November 2014|volume=70|issue=11|pages=1313–24|doi=10.1007/s00228-014-1748-0|pmid=25217187|type=Review}}</ref> 87% (rectal) |
|||
| protein_bound = 98%<ref name = clinp>{{cite journal|last=Davies|first=NM|title=Clinical pharmacokinetics of ibuprofen. The first 30 years.|journal=Clinical Pharmacokinetics|date=February 1998|volume=34|issue=2|pages=101–54|doi=10.2165/00003088-199834020-00002|pmid=9515184}}</ref> |
|||
| metabolism = Liver ([[CYP2C9]])<ref name = clinp/> |
|||
| metabolites = ibuprofen glucuronide, 2-hydroxyibuprofen, 3-hydroxyibuprofen, carboxy-ibuprofen, 1-hydroxyibuprofen |
|||
| elimination_half-life = 2–4 h<ref name="Grosser2017">{{cite journal|last1=Grosser|first1=T|last2=Ricciotti|first2=E|last3=FitzGerald|first3=GA|title=The Cardiovascular Pharmacology of Nonsteroidal Anti-Inflammatory Drugs|journal=Trends in Pharmacological Sciences|date=August 2017|volume=38|issue=8|pages=733–48|doi=10.1016/j.tips.2017.05.008|pmid=28651847|pmc=5676556|type=Review}}</ref> |
|||
| onset = 30 min<ref>{{cite web|title=ibuprofen|url=http://web.squ.edu.om/med-lib/med_cd/e_cds/Nursing%20Drug%20Guide/mg/ibuprofen.htm|accessdate=31 January 2015|deadurl=no|archiveurl=https://web.archive.org/web/20150113042104/http://web.squ.edu.om/med-Lib/MED_CD/E_CDs/Nursing%20Drug%20Guide/mg/ibuprofen.htm|archivedate=13 January 2015|df=dmy-all}}</ref> |
|||
| excretion = Urine (95%)<ref name = clinp/><ref name=TGA>{{cite web|title=Brufen Tablets And Syrup|publisher=Therapeutic Goods Administration|date=31 July 2012|accessdate=8 May 2014|url=https://www.ebs.tga.gov.au/ebs/picmi/picmirepository.nsf/pdf?OpenAgent&id=CP-2009-PI-00035-3|format=PDF|deadurl=no|archiveurl=https://web.archive.org/web/20160820064609/https://www.ebs.tga.gov.au/ebs/picmi/picmirepository.nsf/pdf?OpenAgent&id=CP-2009-PI-00035-3|archivedate=20 August 2016|df=dmy-all}}</ref> |
|||
<!--Identifiers--> |
|||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
| CAS_number = 15687-27-1 |
|||
| ATC_prefix = C01 |
|||
| ATC_suffix = EB16 |
|||
| ATC_supplemental = {{ATC|G02|CC01}} {{ATC|M01|AE01}} {{ATC|M02|AA13}} {{ATC|R02|AX02}} |
|||
| PubChem = 3672 |
|||
| IUPHAR_ligand = 2713 |
|||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|||
| DrugBank = DB01050 |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| ChemSpiderID = 3544 |
|||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| UNII = WK2XYI10QM |
|||
| KEGG_Ref = {{keggcite|correct|kegg}} |
|||
| KEGG = D00126 |
|||
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|||
| ChEBI = 5855 |
|||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| ChEMBL = 521 |
|||
| PDB_ligand = IBP |
|||
<!--Chemical data--> |
|||
| C=13 | H=18 | O=2 |
|||
| molecular_weight = 206.29 g/mol |
|||
| smiles = CC(C)Cc1ccc(cc1)[C@@H](C)C(=O)O |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChI = 1S/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15) |
|||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChIKey = HEFNNWSXXWATRW-UHFFFAOYSA-N |
|||
| melting_point = 75 |
|||
| melting_high = 78 |
|||
| boiling_point = 157 |
|||
| boiling_notes = at 4 mmHg |
|||
| solubility = 0.021 |
|||
| density = 1.03 g/ml |
|||
| chirality = [[Racemic mixture]] |
|||
}} |
|||
'''이부프로펜'''(Ibuprofen, 이전 이름: 이소 부틸 프로판 페놀산)은 [[비스테로이드 항염증제]]로, 원래 상표명은 부루펜(Brufen)이다. 나라마다 다른 상표명이 있다. [[진통]], [[관절염]] 제거, [[해열]]에, 특히 이들 [[증상]]이 [[염증]]을 동반하는 경우에 쓴다. [[아스피린]]에 비해서는 약하면서도 반감기가 짧기는 하지만, [[용혈작용]]이 있다. [[아세트아미노펜]]과는 달리, [[위 (해부학)|위장]]에 영향을 줄 수 있으므로 공복을 피하여 복용해야 하며, 특히 [[술]]을 마신 상태에서 복용 시 위장 [[출혈]]을 유발할 수 있으므로 피해야 한다. |
'''이부프로펜'''(Ibuprofen, 이전 이름: 이소 부틸 프로판 페놀산)은 [[비스테로이드 항염증제]]로, 원래 상표명은 부루펜(Brufen)이다. 나라마다 다른 상표명이 있다. [[진통]], [[관절염]] 제거, [[해열]]에, 특히 이들 [[증상]]이 [[염증]]을 동반하는 경우에 쓴다. [[아스피린]]에 비해서는 약하면서도 반감기가 짧기는 하지만, [[용혈작용]]이 있다. [[아세트아미노펜]]과는 달리, [[위 (해부학)|위장]]에 영향을 줄 수 있으므로 공복을 피하여 복용해야 하며, 특히 [[술]]을 마신 상태에서 복용 시 위장 [[출혈]]을 유발할 수 있으므로 피해야 한다. |
||
2019년 3월 16일 (토) 12:18 판
체계적 명칭 (IUPAC 명명법) | |
---|---|
(RS)-2-(4-(2-Methylpropyl)phenyl)propanoic acid | |
식별 정보 | |
CAS 등록번호 | 15687-27-1 |
ATC 코드 | C01EB16 G02CC01 M01AE01 M02AA13 R02AX02 |
PubChem | 3672 |
드러그뱅크 | DB01050 |
ChemSpider | 3544 |
화학적 성질 | |
화학식 | C13H18O2 |
분자량 | 206.29 g/mol |
SMILES | eMolecules & PubChem |
유의어 | isobutylphenylpropionic acid |
물리적 성질 | |
밀도 | 1.03 g/ml g/cm³ |
녹는점 | 75–78 °C (167–172 °F) |
끓는점 | 157 °C (315 °F) at 4 mmHg |
물에 대한 용해도 | 0.021 mg/mL (20 °C) |
약동학 정보 | |
생체적합성 | 80–100% (by mouth),[1] 87% (rectal) |
단백질 결합 | 98%[2] |
동등생물의약품 | ? |
약물 대사 | Liver (CYP2C9)[2] |
생물학적 반감기 | 2–4 h[3] |
배출 | Urine (95%)[2][4] |
처방 주의사항 | |
허가 정보 | |
임부투여안전성 | C(오스트레일리아)C(미국)D (US) at ≥30 weeks of gestation, due to the potential for premature closure of the ductus arteriosus |
법적 상태 |
|
투여 방법 | by mouth, rectal, topical, and intravenous |
이부프로펜(Ibuprofen, 이전 이름: 이소 부틸 프로판 페놀산)은 비스테로이드 항염증제로, 원래 상표명은 부루펜(Brufen)이다. 나라마다 다른 상표명이 있다. 진통, 관절염 제거, 해열에, 특히 이들 증상이 염증을 동반하는 경우에 쓴다. 아스피린에 비해서는 약하면서도 반감기가 짧기는 하지만, 용혈작용이 있다. 아세트아미노펜과는 달리, 위장에 영향을 줄 수 있으므로 공복을 피하여 복용해야 하며, 특히 술을 마신 상태에서 복용 시 위장 출혈을 유발할 수 있으므로 피해야 한다.
역사
이부프로펜은 1960년대 동안 부츠 그룹의 연구 부문에 의해 프로피온산에서 추출된 것이다.[5]
같이 보기
각주
- ↑ Davanzo, R; Bua, J; Paloni, G; Facchina, G (November 2014). “Breastfeeding and migraine drugs”. 《European Journal of Clinical Pharmacology》 (Review) 70 (11): 1313–24. doi:10.1007/s00228-014-1748-0. PMID 25217187.
- ↑ 가 나 다 Davies, NM (February 1998). “Clinical pharmacokinetics of ibuprofen. The first 30 years.”. 《Clinical Pharmacokinetics》 34 (2): 101–54. doi:10.2165/00003088-199834020-00002. PMID 9515184.
- ↑ Grosser, T; Ricciotti, E; FitzGerald, GA (August 2017). “The Cardiovascular Pharmacology of Nonsteroidal Anti-Inflammatory Drugs”. 《Trends in Pharmacological Sciences》 (Review) 38 (8): 733–48. doi:10.1016/j.tips.2017.05.008. PMC 5676556. PMID 28651847.
- ↑ “Brufen Tablets And Syrup”. Therapeutic Goods Administration. 31 July 2012. 20 August 2016에 보존된 문서. 8 May 2014에 확인함.
- ↑ Adams, SS (April 1992). “The propionic acids: a personal perspective.”. 《Journal of Clinical Pharmacology》 32 (4): 317–23. doi:10.1002/j.1552-4604.1992.tb03842.x. PMID 1569234.