코카인: 두 판 사이의 차이
내용 삭제됨 내용 추가됨
잔글 +분류:메틸 에스터 |
편집 요약 없음 |
||
1번째 줄: | 1번째 줄: | ||
{{Infobox drug |
|||
[[파일:Cocaine.svg|섬네일]] |
|||
| Verifiedfields = changed |
|||
| Watchedfields = changed |
|||
| verifiedrevid = 477165921 |
|||
| drug_name = |
|||
| IUPAC_name = Methyl (1''R'',2''R'',3''S'',5''S'')-3-(benzoyloxy)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
|||
| image = Kokain - Cocaine.svg |
|||
| image2 = Cocaine-from-xtal-1983-3D-balls.png |
|||
<!--Clinical data--> |
|||
| pronounce = kəʊˈkeɪn |
|||
| Drugs.com = {{drugs.com|CONS|cocaine}} |
|||
| tradename = Neurocaine,<ref>{{cite book |last1=Nordegren |first1=Thomas |title=The A-Z Encyclopedia of Alcohol and Drug Abuse |date=2002 |publisher=Universal-Publishers |isbn=9781581124040 |page=461 |url=https://books.google.ca/books?id=4yaGePenGKgC&pg=PA461 |language=en}}</ref> other |
|||
| pregnancy_US = C |
|||
| legal_AU = Schedule 8 |
|||
| legal_CA = Schedule I |
|||
| legal_DE = Anlage III |
|||
| legal_NZ = Class A |
|||
| legal_UK = Class A |
|||
| legal_US = Schedule II<ref name=DEA2017Sched>{{cite web|title=DEA / Drug Scheduling|url=https://www.dea.gov/druginfo/ds.shtml|website=www.dea.gov|access-date=7 August 2017|deadurl=no|archive-url=https://web.archive.org/web/20170809044016/https://www.dea.gov/druginfo/ds.shtml|archive-date=9 August 2017|df=dmy-all}}</ref> |
|||
| legal_UN = N I III |
|||
| legal_status = |
|||
| dependency_liability = {{plainlist| |
|||
*[[Physical dependence|Physical]]: none<ref>{{cite book |vauthors=Malenka RC, Nestler EJ, Hyman SE |veditors=Sydor A, Brown RY | title = Molecular Neuropharmacology: A Foundation for Clinical Neuroscience | year = 2009 | publisher = McGraw-Hill Medical | location = New York | isbn = 978-0-07-148127-4 | edition = 2nd | chapter = Chapter 15: Reinforcement and Addictive Disorders | page = 367 | quote= While physical dependence and withdrawal occur with some drugs of abuse (opiates, ethanol), these phenomena are not useful in the diagnosis of addiction because they do not occur with other drugs of abuse (cocaine, amphetamine) and can occur with many drugs that are not abused (propranolol, clonidine).}}</ref> |
|||
*[[Psychological dependence|Psychological]]: High<ref name=Gho2010>{{cite book| first1 = Hamid | last1 = Ghodse | name-list-format = vanc | title = Ghodse's Drugs and Addictive Behaviour: A Guide to Treatment|date=2010|publisher=Cambridge University Press|isbn=978-1-139-48567-8|page=91|edition=4|url=https://books.google.com/books?id=WYQ23OMjWbcC&pg=PA91|deadurl=no|archive-url=https://web.archive.org/web/20170910234911/https://books.google.com/books?id=WYQ23OMjWbcC&pg=PA91|archive-date=10 September 2017|df=dmy-all}}</ref>}} |
|||
| addiction_liability = High<ref>{{cite book|title=Introduction to Pharmacology Third Edition|date=2007|publisher=CRC Press|location=Abingdon|isbn=978-1-4200-4742-4|pages=222–223|url=https://books.google.com/books?id=qfrLBQAAQBAJ&pg=PA222|deadurl=no|archive-url=https://web.archive.org/web/20170910234921/https://books.google.com/books?id=qfrLBQAAQBAJ&pg=PA222|archive-date=10 September 2017|df=dmy-all}}</ref> |
|||
| routes_of_administration = [[Topical]], [[route of administration#Oral|oral]], [[insufflation (medicine)|insufflation]], [[intravenous]] |
|||
| class = {{plainlist| |
|||
*{{abbr|CNS|central nervous system}} [[stimulant]] |
|||
*[[Local anesthetic]]}} |
|||
<!--Pharmacokinetic data--> |
|||
| bioavailability = {{plainlist| |
|||
*[[route of administration#Oral|By mouth]]: 33%<ref name="fattinger2000">{{cite journal | vauthors = Fattinger K, Benowitz NL, Jones RT, Verotta D | title = Nasal mucosal versus gastrointestinal absorption of nasally administered cocaine | journal = European Journal of Clinical Pharmacology | volume = 56 | issue = 4 | pages = 305–10 | date = July 2000 | pmid = 10954344 | doi = 10.1007/s002280000147 }}</ref> |
|||
*[[Insufflation (medicine)|insufflated]]: 60<ref>{{cite journal | vauthors = Barnett G, Hawks R, Resnick R | title = Cocaine pharmacokinetics in humans | journal = Journal of Ethnopharmacology | volume = 3 | issue = 2–3 | pages = 353–66 | year = 1981 | pmid = 7242115 | doi = 10.1016/0378-8741(81)90063-5 }}</ref>–80%<ref>{{cite journal | vauthors = Jeffcoat AR, Perez-Reyes M, Hill JM, Sadler BM, Cook CE | title = Cocaine disposition in humans after intravenous injection, nasal insufflation (snorting), or smoking | journal = Drug Metabolism and Disposition | volume = 17 | issue = 2 | pages = 153–9 | year = 1989 | pmid = 2565204 }}</ref> |
|||
*[[Nasal spray]]: 25<ref>{{cite journal | vauthors = Wilkinson P, Van Dyke C, Jatlow P, Barash P, Byck R | title = Intranasal and oral cocaine kinetics | journal = Clinical Pharmacology and Therapeutics | volume = 27 | issue = 3 | pages = 386–94 | date = March 1980 | pmid = 7357795 | doi = 10.1038/clpt.1980.52 }}</ref>–43%<ref name="fattinger2000" />}} |
|||
| metabolism = [[liver]] [[CYP3A4]] |
|||
| metabolites = [[Norcocaine]], [[benzoylecgonine]], [[cocaethylene]] |
|||
| onset = seconds to minutes<ref name="Zimmerman2012"/> |
|||
| elimination_half-life = 1 hour |
|||
| duration_of_action=5 to 90 minutes<ref name="Zimmerman2012"/> |
|||
| excretion = Kidney |
|||
<!--Identifiers--> |
|||
| index_label = |
|||
| index2_label = |
|||
| CAS_number_Ref = {{cascite|correct|CAS}} |
|||
| CAS_number = 50-36-2 |
|||
| CAS_number2 = 53-21-4 |
|||
| ATC_prefix = N01 |
|||
| ATC_suffix = BC01 |
|||
| ATC_supplemental = {{ATC|R02|AD03}}, {{ATC|S01|HA01}}, {{ATC|S02|DA02}} |
|||
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|||
| ChEBI = 27958 |
|||
| PubChem = 446220 |
|||
| IUPHAR_ligand = 2286 |
|||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|||
| DrugBank = DB00907 |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| ChemSpiderID = 10194104 |
|||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| UNII = I5Y540LHVR |
|||
| KEGG_Ref = {{keggcite|correct|kegg}} |
|||
| KEGG = D00110 |
|||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| ChEMBL = 370805 |
|||
| PDB_ligand = COC |
|||
<!--Chemical data--> |
|||
| C=17 |H=21 |N=1 |O=4 |
|||
| molecular_weight = 303.353 g/mol |
|||
| smiles = CN1[C@H]2CC[C@@H]1[C@@H](C(OC)=O)[C@@H](OC(C3=CC=CC=C3)=O)C2 |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChI = 1S/C17H21NO4/c1-18-12-8-9-13(18)15(17(20)21-2)14(10-12)22-16(19)11-6-4-3-5-7-11/h3-7,12-15H,8-10H2,1-2H3/t12-,13+,14-,15+/m0/s1 |
|||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChIKey = ZPUCINDJVBIVPJ-LJISPDSOSA-N |
|||
| synonyms = Benzoylmethylecgonine, coke |
|||
| melting_point = 98<!--Pubchem--> |
|||
| boiling_point = 187 |
|||
| solubility = ~1.8<!--Pubchem--> |
|||
}} |
|||
'''코카인'''({{llang|en|cocaine}})은 [[코카나무]] 잎에서 추출하는 [[알칼로이드]]이다. [[중추 신경]]을 자극하여 [[식욕 감퇴]]를 일으켜 쾌감을 일으킨다. 19세기에서 20세기까지는 국소 마취제로 쓰기도 했다. 중독성이 있기 때문에 전 세계적으로 의학적인 용도 이외로 코카인을 소지하는 것은 불법이다. 화학식은 C<sub>17</sub>H<sub>21</sub>NO<sub>4</sub>이다. |
'''코카인'''({{llang|en|cocaine}})은 [[코카나무]] 잎에서 추출하는 [[알칼로이드]]이다. [[중추 신경]]을 자극하여 [[식욕 감퇴]]를 일으켜 쾌감을 일으킨다. 19세기에서 20세기까지는 국소 마취제로 쓰기도 했다. 중독성이 있기 때문에 전 세계적으로 의학적인 용도 이외로 코카인을 소지하는 것은 불법이다. 화학식은 C<sub>17</sub>H<sub>21</sub>NO<sub>4</sub>이다. |
2019년 4월 5일 (금) 02:00 판
체계적 명칭 (IUPAC 명명법) | |
---|---|
Methyl (1R,2R,3S,5S)-3-(benzoyloxy)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate | |
식별 정보 | |
CAS 등록번호 | 50-36-2 |
ATC 코드 | N01BC01 R02AD03, S01HA01, S02DA02 |
PubChem | 446220 |
드러그뱅크 | DB00907 |
ChemSpider | 10194104 |
화학적 성질 | |
화학식 | C17H21NO4 |
분자량 | 303.353 g/mol |
SMILES | eMolecules & PubChem |
유의어 | Benzoylmethylecgonine, coke |
물리적 성질 | |
녹는점 | 98 °C (208 °F) |
끓는점 | 187 °C (369 °F) |
물에 대한 용해도 | ~1.8 mg/mL (20 °C) |
약동학 정보 | |
생체적합성 |
|
동등생물의약품 | ? |
약물 대사 | liver CYP3A4 |
생물학적 반감기 | 1 hour |
배출 | Kidney |
처방 주의사항 | |
임부투여안전성 | C(미국) |
법적 상태 |
|
중독 경향 |
|
투여 방법 | Topical, oral, insufflation, intravenous |
코카인(영어: cocaine)은 코카나무 잎에서 추출하는 알칼로이드이다. 중추 신경을 자극하여 식욕 감퇴를 일으켜 쾌감을 일으킨다. 19세기에서 20세기까지는 국소 마취제로 쓰기도 했다. 중독성이 있기 때문에 전 세계적으로 의학적인 용도 이외로 코카인을 소지하는 것은 불법이다. 화학식은 C17H21NO4이다.
중국 음료에서 코카인 검출
- 2009년 6월 중국인들이 마시는 에너지 음료 '레드불(紅牛, Red Bull)'에서 코카인이 검출됐다.[8]
- 홍콩 정부가 해당 제품 3종을 긴급 수거해 화학 실험을 한 결과, 리터당 0.1∼0.3㎎의 코카인이 검출된 것으로 밝혀졌다.
- 문제가 된 '홍뉴'는 오스트리아 현지 공장에서 생산된 제품이다.
- 대만은 수입한 77만2천500달러 상당의 '훙뉴' 1만8천 상자를 전격 압수했다.
- 독일은 '홍뉴 콜라'에 대해 판매 금지령을 내렸다.[9]
- 전 세계 130여개 국가에서 소비되고 있다.
같이 보기
각주와 인용
- ↑ 가 나 Fattinger K, Benowitz NL, Jones RT, Verotta D (July 2000). “Nasal mucosal versus gastrointestinal absorption of nasally administered cocaine”. 《European Journal of Clinical Pharmacology》 56 (4): 305–10. doi:10.1007/s002280000147. PMID 10954344.
- ↑ Barnett G, Hawks R, Resnick R (1981). “Cocaine pharmacokinetics in humans”. 《Journal of Ethnopharmacology》 3 (2–3): 353–66. doi:10.1016/0378-8741(81)90063-5. PMID 7242115.
- ↑ Jeffcoat AR, Perez-Reyes M, Hill JM, Sadler BM, Cook CE (1989). “Cocaine disposition in humans after intravenous injection, nasal insufflation (snorting), or smoking”. 《Drug Metabolism and Disposition》 17 (2): 153–9. PMID 2565204.
- ↑ Wilkinson P, Van Dyke C, Jatlow P, Barash P, Byck R (March 1980). “Intranasal and oral cocaine kinetics”. 《Clinical Pharmacology and Therapeutics》 27 (3): 386–94. doi:10.1038/clpt.1980.52. PMID 7357795.
- ↑ “DEA / Drug Scheduling”. 《www.dea.gov》. 9 August 2017에 보존된 문서. 7 August 2017에 확인함.
- ↑ Malenka RC, Nestler EJ, Hyman SE (2009). 〈Chapter 15: Reinforcement and Addictive Disorders〉. Sydor A, Brown RY. 《Molecular Neuropharmacology: A Foundation for Clinical Neuroscience》 2판. New York: McGraw-Hill Medical. 367쪽. ISBN 978-0-07-148127-4.
While physical dependence and withdrawal occur with some drugs of abuse (opiates, ethanol), these phenomena are not useful in the diagnosis of addiction because they do not occur with other drugs of abuse (cocaine, amphetamine) and can occur with many drugs that are not abused (propranolol, clonidine).
- ↑ Ghodse H (2010). 《Ghodse's Drugs and Addictive Behaviour: A Guide to Treatment》 4판. Cambridge University Press. 91쪽. ISBN 978-1-139-48567-8. 10 September 2017에 보존된 문서.
- ↑ 류재복 특파원 (2009년 6월 3일). “대중이 즐기는 음료에서 코카인이!”. YTN. 2009년 6월 4일에 확인함.
- ↑ 박근정 기자 (2009년 6월 3일). “中음료수 '홍뉴' 마약 코카인 성분 검출 파장 '충격'”. 뉴스한국닷컴. 2009년 6월 4일에 확인함.
이 글은 의학에 관한 토막글입니다. 여러분의 지식으로 알차게 문서를 완성해 갑시다. |