지프라시돈: 두 판 사이의 차이

위키백과, 우리 모두의 백과사전.
입체적으로 역사 찾아보기
← 이전 편집다음 편집 →
내용 삭제됨 내용 추가됨
시각위키텍스트
Choboty (토론 | 기여)
봇
1,795,794 편집
편집 요약 없음
1번째 줄: 1번째 줄:
{{Drugbox
⚫
지프라시돈(Ziprasidone)은 [[정신 분열증]]과 [[양극성 장애]]등을 치료하는 데 사용되는 항정신성 약으로 알려져있다. 경구 복용과 근육(IM) 주사용이 있다.
| Watchedfields = changed
| verifiedrevid = 470637441
| IUPAC_name = 5-{2-[4-(1,2-benzisothiazol-3-yl)-1-piperazinyl]ethyl}-6-chloro-1,3-dihydro-2''H''-indol-2-one
| image = Ziprasidone.svg
| width = 275
| image2 = Ziprasidone ball-and-stick model.png

<!--Clinical data-->
| tradename = Geodon, Zeldox, Zipwell, other
| Drugs.com = {{drugs.com|monograph|ziprasidone}}
| MedlinePlus = a699062
| DailyMedID = Ziprasidone
| licence_US = Ziprasidone
| pregnancy_AU = C
| pregnancy_US = C
| legal_AU = S4
| legal_US = Rx-only
| routes_of_administration = [[Oral administration|By mouth]] ([[Capsule (pharmacy)|capsules]]), [[intramuscular injection]] (IM)

<!--Pharmacokinetic data-->
| bioavailability = 60% (oral)<ref name=2011rev>{{cite journal|last1=Stahl|last2=Chiara Mattei|last3=Maria Paola Rapagnani|title=Ziprasidone Hydrocloride: What Role in the Management of Schizophrenia?|journal=Journal of Central Nervous System Disease|date=February 2011|pages=1–16|pmid=23861634|pmc=3663608|doi=10.4137/JCNSD.S4138|volume=3}}</ref>
<br />100% (IM)
| metabolism = Liver ([[aldehyde reductase]])
| elimination_half-life = 7 to 10 hours<ref name=2007rev>{{cite journal|title=Ziprasidone in the treatment of mania in bipolar disorder|journal=Neuropsychiatr Dis Treat|date=December 2007|volume=3|issue=6|pages=823–34|pmid=19300617|pmc=2656324|last1=Nicolson|first1= SE |last2=Nemeroff |first2=CB|doi=10.2147/NDT.S794}}</ref>
| excretion = Urine and feces

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 146939-27-7
| ATC_prefix = N05
| ATC_suffix = AE04
| PubChem = 60854
| IUPHAR_ligand = 59
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00246
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 54841
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 6UKA5VEJ6X
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D08687
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 10119
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 708

<!--Chemical data-->
| C=21 | H=21 | Cl=1 | N=4 | O=1 | S=1
| SMILES = O=C1Cc2c(N1)cc(Cl)c(c2)CCN3CCN(CC3)c4nsc5ccccc45
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C21H21ClN4OS/c22-17-13-18-15(12-20(27)23-18)11-14(17)5-6-25-7-9-26(10-8-25)21-16-3-1-2-4-19(16)28-24-21/h1-4,11,13H,5-10,12H2,(H,23,27)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = MVWVFYHBGMAFLY-UHFFFAOYSA-N
}}
⚫
'''지프라시돈'''(Ziprasidone)은 [[정신 분열증]]과 [[양극성 장애]]등을 치료하는 데 사용되는 항정신성 약으로 알려져있다. 경구 복용과 근육(IM) 주사용이 있다.
체중 증가를 유발할 수 있지만 다른 항정신약에 비해 위험이 훨씬 낮다고 알려져있다.<ref name=TGA-Zeldox-IM>{{웹 인용|title=Product Information: Zeldox IM (ziprasidone mesilate)|url=https://www.ebs.tga.gov.au/ebs/picmi/picmirepository.nsf/pdf?OpenAgent&id=CP-2010-PI-06852-3|publisher=Australia Therapeutic Goods Administration|date=February 24, 2016}}</ref><ref name=TGA-Zeldox>{{웹 인용|title=Product Information: Zeldox (ziprasidone hydrochloride)|url=https://www.ebs.tga.gov.au/ebs/picmi/picmirepository.nsf/pdf?OpenAgent&id=CP-2010-PI-05917-3&d=2016100716114622483|publisher=Australia Therapeutic Goods Administration|date=February 24, 2016}}</ref><ref name=PsychDrugsComm>{{웹 인용|last1=FDA Psychopharmacological Drugs Advisory Committee|title=Briefing Document for Zeldoz Capsules|url=https://www.fda.gov/ohrms/dockets/ac/00/backgrd/3619b1a.pdf|publisher=FDA|date=July 19, 2000}}</ref> 작용에대해서는 뇌의 [[세로토닌]]과 [[도파민]]에 연관되는것으로 여겨진다.<ref name=AHFS2019>{{웹 인용|title=Ziprasidone Monograph for Professionals |url=https://www.drugs.com/monograph/ziprasidone.html |website=Drugs.com |publisher=American Society of Health-System Pharmacists |accessdate=8 May 2019 |language=en}}</ref>
체중 증가를 유발할 수 있지만 다른 항정신약에 비해 위험이 훨씬 낮다고 알려져있다.<ref name=TGA-Zeldox-IM>{{웹 인용|title=Product Information: Zeldox IM (ziprasidone mesilate)|url=https://www.ebs.tga.gov.au/ebs/picmi/picmirepository.nsf/pdf?OpenAgent&id=CP-2010-PI-06852-3|publisher=Australia Therapeutic Goods Administration|date=February 24, 2016}}</ref><ref name=TGA-Zeldox>{{웹 인용|title=Product Information: Zeldox (ziprasidone hydrochloride)|url=https://www.ebs.tga.gov.au/ebs/picmi/picmirepository.nsf/pdf?OpenAgent&id=CP-2010-PI-05917-3&d=2016100716114622483|publisher=Australia Therapeutic Goods Administration|date=February 24, 2016}}</ref><ref name=PsychDrugsComm>{{웹 인용|last1=FDA Psychopharmacological Drugs Advisory Committee|title=Briefing Document for Zeldoz Capsules|url=https://www.fda.gov/ohrms/dockets/ac/00/backgrd/3619b1a.pdf|publisher=FDA|date=July 19, 2000}}</ref> 작용에대해서는 뇌의 [[세로토닌]]과 [[도파민]]에 연관되는것으로 여겨진다.<ref name=AHFS2019>{{웹 인용|title=Ziprasidone Monograph for Professionals |url=https://www.drugs.com/monograph/ziprasidone.html |website=Drugs.com |publisher=American Society of Health-System Pharmacists |accessdate=8 May 2019 |language=en}}</ref>


2020년 11월 4일 (수) 21:03 판

지프라시돈
체계적 명칭 (IUPAC 명명법)
5-{2-[4-(1,2-benzisothiazol-3-yl)-1-piperazinyl]ethyl}-6-chloro-1,3-dihydro-2H-indol-2-one
식별 정보
CAS 등록번호 146939-27-7
ATC 코드 N05AE04
PubChem 60854
드러그뱅크 DB00246
ChemSpider 54841
화학적 성질
화학식 C21H21ClN4OS 
분자량 ?
약동학 정보
생체적합성 60% (oral)[1]


100% (IM)

동등생물의약품 ?
약물 대사 Liver (aldehyde reductase)
생물학적 반감기 7 to 10 hours[2]
배출 Urine and feces
처방 주의사항
허가 정보

US Daily Med:바로가기

임부투여안전성 C(오스트레일리아)C(미국)
법적 상태
투여 방법 By mouth (capsules), intramuscular injection (IM)

지프라시돈(Ziprasidone)은 정신 분열증과 양극성 장애등을 치료하는 데 사용되는 항정신성 약으로 알려져있다. 경구 복용과 근육(IM) 주사용이 있다. 체중 증가를 유발할 수 있지만 다른 항정신약에 비해 위험이 훨씬 낮다고 알려져있다.[3][4][5] 작용에대해서는 뇌의 세로토닌과 도파민에 연관되는것으로 여겨진다.[6]

지프라시돈은 2001년 미국에서 의료용으로 승인되었다. 알약은 지프라시돈 하이드로클로라이드(ziprasidone hydrochloride)로 구성된다.

같이 보기

참고

  1. ↑ Stahl; Chiara Mattei; Maria Paola Rapagnani (February 2011). “Ziprasidone Hydrocloride: What Role in the Management of Schizophrenia?”. 《Journal of Central Nervous System Disease》 3: 1–16. doi:10.4137/JCNSD.S4138. PMC 3663608. PMID 23861634. 
  2. ↑ Nicolson, SE; Nemeroff, CB (December 2007). “Ziprasidone in the treatment of mania in bipolar disorder”. 《Neuropsychiatr Dis Treat》 3 (6): 823–34. doi:10.2147/NDT.S794. PMC 2656324. PMID 19300617. 
  3. ↑ “Product Information: Zeldox IM (ziprasidone mesilate)”. Australia Therapeutic Goods Administration. 2016년 2월 24일. 
  4. ↑ “Product Information: Zeldox (ziprasidone hydrochloride)”. Australia Therapeutic Goods Administration. 2016년 2월 24일. 
  5. ↑ FDA Psychopharmacological Drugs Advisory Committee (2000년 7월 19일). “Briefing Document for Zeldoz Capsules” (PDF). FDA. 
  6. ↑ “Ziprasidone Monograph for Professionals”. 《Drugs.com》 (영어). American Society of Health-System Pharmacists. 2019년 5월 8일에 확인함. 
원본 주소 "https://ko.wikipedia.org/w/index.php?title=지프라시돈&oldid=27962648"