트라조돈: 두 판 사이의 차이
내용 삭제됨 내용 추가됨
잔글 +분류:수면제 |
편집 요약 없음 |
||
1번째 줄: | 1번째 줄: | ||
{{Drugbox |
|||
| Watchedfields = changed |
|||
| verifiedrevid = 457287206 |
|||
| IUPAC_name = 2-<nowiki/>{3-[4-(3-Chlorophenyl)piperazin-1-yl]propyl}[1,2,4]triazolo[4,3-''a'']pyridin-3(2''H'')-one |
|||
| image = Trazodone.svg |
|||
| width = 250px |
|||
| image2 = Trazodone-from-HCl-xtal-3D-balls.png |
|||
| width2 = 250px |
|||
<!--Clinical data--> |
|||
| tradename = Many brand names worldwide<ref name=genericnames/> |
|||
| synonyms = AF-1161 |
|||
| Drugs.com = {{drugs.com|monograph|trazodone-hydrochloride}} |
|||
| MedlinePlus = a681038 |
|||
| pregnancy_US = C |
|||
| legal_US = Rx-only |
|||
| legal_UK = POM |
|||
| legal_AU = S4 |
|||
| legal_CA = Rx-only |
|||
| routes_of_administration = [[Oral administration|By mouth]] ([[tablet (pharmacy)|tablets]]) |
|||
<!--Pharmacokinetic data--> |
|||
| bioavailability = [[Oral administration|By mouth]]: 65%<ref name="DrugPoint">Truven Health Analytics, Inc. DrugPoint System (Internet) [cited 2013 Oct 1]. Greenwood Village, CO: Thomsen Healthcare; 2013. {{Failed verification|date=April 2017|reason=search for "Trazodone" fails on Truven Web site}}</ref> |
|||
| protein_bound = 89–95%<ref>{{cite web|url=http://www.drugbank.ca/drugs/DB00656| title=Trazodone|website=DrugBank|accessdate=7 June 2015}}</ref> |
|||
| metabolism = [[Liver]] ([[CYP3A4]])<ref>{{cite book |last1=Lemke |first1=Thomas L. |last2=Williams |first2=David A. |title=Foye's Principles of Medicinal Chemistry |date=2012 |publisher=Lippincott Williams & Wilkins |isbn=9781609133450 |page=615 |url=https://books.google.ca/books?id=Sd6ot9ul-bUC&pg=PA615 |language=en}}</ref> |
|||
| metabolites = {{abbrlink|mCPP|meta-Chlorophenylpiperazine}}<ref name="PreskornStanga2012">{{cite book|author1=Sheldon H. Preskorn|author2=Christina Y. Stanga|author3=John P. Feighner|author4=Ruth Ross|title=Antidepressants: Past, Present and Future|url=https://books.google.com/books?id=Ue3uCAAAQBAJ&pg=PA68|date=6 December 2012|publisher=Springer Science & Business Media|isbn=978-3-642-18500-7|pages=68–}}</ref> |
|||
| onset = [[Oral administration|By mouth]]: 1 hour ([[Tmax (pharmacology)|{{abbr|T<sub>max</sub>|Time to peak concentrations}}]])<ref>{{cite web |url=http://www.pharmacychoice.com/mdx/drugpoint.cfm?docID=622860&letter=T&type=Generic%20Name |title=MicroMedex DrugPoints - Trazodone|website=Pharmacy Choice|date= |author= |accessdate= 20 April 2017}}</ref> |
|||
| elimination_half-life = Trazodone {{abbr|IR|immediate-release}}: 7 hours<ref name="DrugPoint" /><br />Trazodone {{abbr|ER|extended-release}}: 10 hours<ref name="DrugPoint" /><br />{{abbrlink|mCPP|meta-Chlorophenylpiperazine}}: 4–8 hours<ref name="SchatzbergNemeroff2017">{{cite book|vauthors = Schatzberg AF,Nemeroff CB|title=The American Psychiatric Association Publishing Textbook of Psychopharmacology, Fifth Edition|url=https://books.google.com/books?id=KfHEDgAAQBAJ&pg=PA460|year=2017|publisher=American Psychiatric Pub|isbn=978-1-58562-523-9|pages=460–}}</ref> |
|||
| excretion = [[Urine]]: 70–75%<ref name="DrugPoint" /><br />[[Feces]]: 21%<ref name="DrugPoint" /> |
|||
<!--Identifiers--> |
|||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
| CAS_number = 19794-93-5 |
|||
| ATC_prefix = N06 |
|||
| ATC_suffix = AX05 |
|||
| PubChem = 5533 |
|||
| IUPHAR_ligand = 213 |
|||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|||
| DrugBank = DB00656 |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| ChemSpiderID = 5332 |
|||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| UNII = YBK48BXK30 |
|||
| KEGG_Ref = {{keggcite|correct|kegg}} |
|||
| KEGG = D08626 |
|||
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|||
| ChEBI = 9654 |
|||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| ChEMBL = 621 |
|||
<!--Chemical data--> |
|||
| C=19 | H=22 | Cl=1 | N=5 | O=1 |
|||
| molecular_weight = 371.8641 g/mol |
|||
| melting_point = 87 |
|||
| SMILES = Clc4cccc(N3CCN(CCCN1/N=C2/C=C\C=C/N2C1=O)CC3)c4 |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChI = 1S/C19H22ClN5O/c20-16-5-3-6-17(15-16)23-13-11-22(12-14-23)8-4-10-25-19(26)24-9-2-1-7-18(24)21-25/h1-3,5-7,9,15H,4,8,10-14H2 |
|||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChIKey = PHLBKPHSAVXXEF-UHFFFAOYSA-N |
|||
|drug_name=|alt=|caption=|type=|legal_status=|licence_EU=|pregnancy_AU=|pregnancy_category=|licence_US= |
|||
}} |
|||
'''트라조돈'''(Trazodone, 상품명으로 '트리티코' 등이 사용된다)은 국내 업체인 [[국제약품]] 및 [[명인제약]]에서 생산하는 [[항우울제]]이다. |
'''트라조돈'''(Trazodone, 상품명으로 '트리티코' 등이 사용된다)은 국내 업체인 [[국제약품]] 및 [[명인제약]]에서 생산하는 [[항우울제]]이다. |
||
== 작용 기전 == |
== 작용 기전 == |
||
트라조돈은 SARI(세로토닌 길항제 및 재흡수 억제제) 계열에 속하는 항우울제로서, 신경전달물질을 교정하는 효과가 있어 우울증 치료를 하는데 사용된다. 5HT2A 수용체의 강력한 길항제이며 일부 세로토닌 재흡수를 선택적으로 차단 효과도 있지만, 노르아드레날린의 재흡수를 차단시키지 않은 작용 기전을 가지므로, 항우울 뿐만 아니라, 항불안, 불면증 완화 효과도 나타내므로, 항콜린작용 없이 간과 심장 독성을 나타내지 않는 노인 환자에게 특히 내약성이 우수한 제제이므로, 불면증 치료로 사용할 경우, 의존성이 거의 없으므로, 장기적으로 사용이 가능하다. |
트라조돈은 SARI(세로토닌 길항제 및 재흡수 억제제) 계열에 속하는 항우울제로서, 신경전달물질을 교정하는 효과가 있어 우울증 치료를 하는데 사용된다. 5HT2A 수용체의 강력한 길항제이며 일부 세로토닌 재흡수를 선택적으로 차단 효과도 있지만, 노르아드레날린의 재흡수를 차단시키지 않은 작용 기전을 가지므로, 항우울 뿐만 아니라, 항불안, 불면증 완화 효과도 나타내므로, 항콜린작용 없이 간과 심장 독성을 나타내지 않는 노인 환자에게 특히 내약성이 우수한 제제이므로, 불면증 치료로 사용할 경우, 의존성이 거의 없으므로, 장기적으로 사용이 가능하다. |
||
== 각주 == |
|||
{{각주}} |
|||
{{항우울제}} |
{{항우울제}} |
2019년 4월 5일 (금) 21:52 판
체계적 명칭 (IUPAC 명명법) | |
---|---|
2-{3-[4-(3-Chlorophenyl)piperazin-1-yl]propyl}[1,2,4]triazolo[4,3-a]pyridin-3(2H)-one | |
식별 정보 | |
CAS 등록번호 | 19794-93-5 |
ATC 코드 | N06AX05 |
PubChem | 5533 |
드러그뱅크 | DB00656 |
ChemSpider | 5332 |
화학적 성질 | |
화학식 | C19H22ClN5O |
분자량 | 371.8641 g/mol |
유의어 | AF-1161 |
물리적 성질 | |
녹는점 | 87 °C (189 °F) |
약동학 정보 | |
생체적합성 | By mouth: 65%[1] |
단백질 결합 | 89–95%[2] |
동등생물의약품 | ? |
약물 대사 | Liver (CYP3A4)[3] |
생물학적 반감기 | Trazodone IR: 7 hours[1] Trazodone ER: 10 hours[1] mCPP: 4–8 hours[4] |
배출 | Urine: 70–75%[1] Feces: 21%[1] |
처방 주의사항 | |
임부투여안전성 | C(미국) |
법적 상태 | |
투여 방법 | By mouth (tablets) |
트라조돈(Trazodone, 상품명으로 '트리티코' 등이 사용된다)은 국내 업체인 국제약품 및 명인제약에서 생산하는 항우울제이다.
작용 기전
트라조돈은 SARI(세로토닌 길항제 및 재흡수 억제제) 계열에 속하는 항우울제로서, 신경전달물질을 교정하는 효과가 있어 우울증 치료를 하는데 사용된다. 5HT2A 수용체의 강력한 길항제이며 일부 세로토닌 재흡수를 선택적으로 차단 효과도 있지만, 노르아드레날린의 재흡수를 차단시키지 않은 작용 기전을 가지므로, 항우울 뿐만 아니라, 항불안, 불면증 완화 효과도 나타내므로, 항콜린작용 없이 간과 심장 독성을 나타내지 않는 노인 환자에게 특히 내약성이 우수한 제제이므로, 불면증 치료로 사용할 경우, 의존성이 거의 없으므로, 장기적으로 사용이 가능하다.
각주
- ↑ 가 나 다 라 마 Truven Health Analytics, Inc. DrugPoint System (Internet) [cited 2013 Oct 1]. Greenwood Village, CO: Thomsen Healthcare; 2013. 틀:Failed verification
- ↑ “Trazodone”. 《DrugBank》. 2015년 6월 7일에 확인함.
- ↑ Lemke, Thomas L.; Williams, David A. (2012). 《Foye's Principles of Medicinal Chemistry》 (영어). Lippincott Williams & Wilkins. 615쪽. ISBN 9781609133450.
- ↑ Schatzberg AF, Nemeroff CB (2017). 《The American Psychiatric Association Publishing Textbook of Psychopharmacology, Fifth Edition》. American Psychiatric Pub. 460–쪽. ISBN 978-1-58562-523-9.
이 글은 의학에 관한 토막글입니다. 여러분의 지식으로 알차게 문서를 완성해 갑시다. |