본문으로 이동

미페프리스톤: 두 판 사이의 차이

편집 요약 없음
(새 문서: '''미페프리스톤'''(Mifepristone)은 '''미프진'''(Mifegyne)이나 '''미페프렉스'''(Mifeprex), '''RU-486'''등의 이름으로 알려진 낙태약이다. 분류:약)
태그: 토막글
 
편집 요약 없음
{{Drugbox
| Watchedfields = changed
| verifiedrevid = 443306800
| IUPAC_name = (8''S'',11''R'',13''S'',14''S'',17''S'')-11-[4-(dimethylamino)phenyl]-17-hydroxy-13-methyl-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[''a'']phenanthren-3-one
| image = Mifepristone structure.svg
| width = 200px
| image2 = Mifepristona3D.png
| width2 = 200px
 
<!--Clinical data-->
| tradename = Mifegyne, Mifeprex, others
| Drugs.com = {{drugs.com|monograph|mifepristone}}
| MedlinePlus = a600042
| pregnancy_US = X
| pregnancy_category = [[Abortifacient|Used for terminating pregnancy]]
| legal_US = Rx-only
| legal_status = Rx-only
| routes_of_administration = [[Oral administration|By mouth]]
| class = [[Antiprogestogen]]; [[Antiglucocorticoid]]
 
<!--Pharmacokinetic data-->
| bioavailability = 69%
| protein_bound = 98%
| metabolism = [[Liver]]
| elimination_half-life =
| excretion = [[Feces]]: 83%<br />[[Urine]]: 9%
 
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 84371-65-3
| ATC_prefix = G03
| ATC_suffix = XB01
| PubChem = 55245
| IUPHAR_ligand = 2805
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00834
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 49889
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 320T6RNW1F
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00585
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 50692
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 157
| synonyms = RU-486; RU-38486; ZK-98296; 11β-[''p''-(Dimethylamino)phenyl]-17α-(1-propynyl)estra-4,9-dien-17β-ol-3-one
 
<!--Chemical data-->
| C=29 | H=35 | N=1 | O=2
| molecular_weight = 429.604 g/mol
| SMILES = O=C5\C=C4/C(=C3/[C@@H](c1ccc(N(C)C)cc1)C[C@]2([C@@H](CC[C@]2(C#CC)O)[C@@H]3CC4)C)CC5
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C29H35NO2/c1-5-15-29(32)16-14-26-24-12-8-20-17-22(31)11-13-23(20)27(24)25(18-28(26,29)2)19-6-9-21(10-7-19)30(3)4/h6-7,9-10,17,24-26,32H,8,11-14,16,18H2,1-4H3/t24-,25+,26-,28-,29-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = VKHAHZOOUSRJNA-GCNJZUOMSA-N
 
<!--Physical data-->
| density = 1.189
| melting_point = 194
| boiling_point = 629
}}
'''미페프리스톤'''(Mifepristone)은 '''미프진'''(Mifegyne)이나 '''미페프렉스'''(Mifeprex), '''RU-486'''등의 이름으로 알려진 [[낙태약]]이다.
 
== 각주 ==
[[분류:약]]
{{각주}}
 
[[분류:아닐린]]
[[분류:프랑스의 발명품]]
[[분류:세계 보건 기구 필수 의약품]]
[[분류:RTT]]